C32H50BrNO3 — CID 177328494
N-[[4-(7-bromoheptoxy)phenyl]methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine (PubChem CID 177328494) has the molecular formula C32H50BrNO3 and a molecular weight of 576.66 g/mol. Its IUPAC name is N-[[4-(7-bromoheptoxy)phenyl]methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine.
| Compound Name | N-[[4-(7-bromoheptoxy)phenyl]methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 177328494 |
| Molecular Formula | C32H50BrNO3 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 575.30 |
| IUPAC Name | N-[[4-(7-bromoheptoxy)phenyl]methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCCNCc2ccc(OCCCCCCCBr)cc2)cc1 |
| InChI | InChI=1S/C32H50BrNO3/c1-31(2,3)26-32(4,5)28-13-17-30(18-14-28)37-24-23-35-22-20-34-25-27-11-15-29(16-12-27)36-21-10-8-6-7-9-19-33/h11-18,34H,6-10,19-26H2,1-5H3 |
| InChIKey | WFUVWKPDWPBRJS-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|