C27H41NO2 — CID 23172546
N-[(2,3-dimethylphenyl)methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine (PubChem CID 23172546) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine.
| Compound Name | N-[(2,3-dimethylphenyl)methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 23172546 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | N-[(2,3-dimethylphenyl)methyl]-2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethanamine |
| SMILES | Cc1cccc(CNCCOCCOc2ccc(C(C)(C)CC(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C27H41NO2/c1-21-9-8-10-23(22(21)2)19-28-15-16-29-17-18-30-25-13-11-24(12-14-25)27(6,7)20-26(3,4)5/h8-14,28H,15-20H2,1-7H3 |
| InChIKey | LIOQYSVNRQCCLK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|