C38H61BrO3 — CID 177328471
1-(7-bromoheptoxy)-4-[4-ethyl-3-methyl-6-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]hexyl]benzene (PubChem CID 177328471) has the molecular formula C38H61BrO3 and a molecular weight of 645.81 g/mol. Its IUPAC name is 1-(7-bromoheptoxy)-4-[4-ethyl-3-methyl-6-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]hexyl]benzene.
| Compound Name | 1-(7-bromoheptoxy)-4-[4-ethyl-3-methyl-6-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]hexyl]benzene |
|---|---|
| PubChem CID | 177328471 |
| Molecular Formula | C38H61BrO3 |
| Molecular Weight | 645.81 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | 1-(7-bromoheptoxy)-4-[4-ethyl-3-methyl-6-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]hexyl]benzene |
| SMILES | CCC(CCOCCOc1ccc(C(C)(C)CC(C)(C)C)cc1)C(C)CCc1ccc(OCCCCCCCBr)cc1 |
| InChI | InChI=1S/C38H61BrO3/c1-8-33(31(2)14-15-32-16-20-35(21-17-32)41-26-13-11-9-10-12-25-39)24-27-40-28-29-42-36-22-18-34(19-23-36)38(6,7)30-37(3,4)5/h16-23,31,33H,8-15,24-30H2,1-7H3 |
| InChIKey | KREXUELHLKYAFI-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.81 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|