C16H15O5S- — CID 22616688
3-(4-benzoylphenoxy)propane-1-sulfonate (PubChem CID 22616688) has the molecular formula C16H15O5S- and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-(4-benzoylphenoxy)propane-1-sulfonate.
| Compound Name | 3-(4-benzoylphenoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 22616688 |
| Molecular Formula | C16H15O5S- |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-(4-benzoylphenoxy)propane-1-sulfonate |
| SMILES | O=C(c1ccccc1)c1ccc(OCCCS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H16O5S/c17-16(13-5-2-1-3-6-13)14-7-9-15(10-8-14)21-11-4-12-22(18,19)20/h1-3,5-10H,4,11-12H2,(H,18,19,20)/p-1 |
| InChIKey | BPLZPLKYBMLWGU-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|