About [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum
[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum (PubChem CID 159586330) has the molecular formula C17H19MoNO2
and a molecular weight of 365.28 g/mol. Its IUPAC name is [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum.
Molecular Properties
| Compound Name | [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum |
| PubChem CID | 159586330 |
| Molecular Formula | C17H19MoNO2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum |
| SMILES | CN(C)CCOc1ccc(C(=O)c2ccccc2)cc1.[Mo] |
| InChI | InChI=1S/C17H19NO2.Mo/c1-18(2)12-13-20-16-10-8-15(9-11-16)17(19)14-6-4-3-5-7-14;/h3-11H,12-13H2,1-2H3; |
| InChIKey | MJQVQOQOMGIEMH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum?
The IUPAC name of [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum (CID 159586330) is [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum.
What is the SMILES notation for [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum?
The canonical SMILES for [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum is CN(C)CCOc1ccc(C(=O)c2ccccc2)cc1.[Mo].
What is the InChIKey of [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum?
The InChIKey is MJQVQOQOMGIEMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2.Mo/c1-18(2)12-13-20-16-10-8-15(9-11-16)17(19)14-6-4-3-5-7-14;/h3-11H,12-13H2,1-2H3;.
What are the key properties of [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum?
[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum has a molecular weight of 365.28 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;molybdenum is sourced from PubChem (CID 159586330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).