C30H29NO4 — CID 159812426
[4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;(4-hydroxyphenyl)-phenylmethanone (PubChem CID 159812426) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;(4-hydroxyphenyl)-phenylmethanone.
| Compound Name | [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;(4-hydroxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 159812426 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [4-[2-(dimethylamino)ethoxy]phenyl]-phenylmethanone;(4-hydroxyphenyl)-phenylmethanone |
| SMILES | CN(C)CCOc1ccc(C(=O)c2ccccc2)cc1.O=C(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H19NO2.C13H10O2/c1-18(2)12-13-20-16-10-8-15(9-11-16)17(19)14-6-4-3-5-7-14;14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h3-11H,12-13H2,1-2H3;1-9,14H |
| InChIKey | NLESTWHKVFIPTH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |