C24H33NO2 — CID 19760990
[4-[9-(dimethylamino)nonoxy]phenyl]-phenylmethanone (PubChem CID 19760990) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is [4-[9-(dimethylamino)nonoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[9-(dimethylamino)nonoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 19760990 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | [4-[9-(dimethylamino)nonoxy]phenyl]-phenylmethanone |
| SMILES | CN(C)CCCCCCCCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H33NO2/c1-25(2)19-11-6-4-3-5-7-12-20-27-23-17-15-22(16-18-23)24(26)21-13-9-8-10-14-21/h8-10,13-18H,3-7,11-12,19-20H2,1-2H3 |
| InChIKey | BAMNSIVVRGDYJB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|