C30H37NO2 — CID 70452870
4-[(Z)-1-[4-[6-(dimethylamino)hexoxy]phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 70452870) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is 4-[(Z)-1-[4-[6-(dimethylamino)hexoxy]phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-[4-[6-(dimethylamino)hexoxy]phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 70452870 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 4-[(Z)-1-[4-[6-(dimethylamino)hexoxy]phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCCCCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H37NO2/c1-4-29(24-12-8-7-9-13-24)30(25-14-18-27(32)19-15-25)26-16-20-28(21-17-26)33-23-11-6-5-10-22-31(2)3/h7-9,12-21,32H,4-6,10-11,22-23H2,1-3H3/b30-29- |
| InChIKey | SYAHXXNKHGXVEB-FLWNBWAVSA-N |
| XLogP | 7.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|