C27H30INO — CID 67686127
3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 67686127) has the molecular formula C27H30INO and a molecular weight of 511.45 g/mol. Its IUPAC name is 3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 67686127 |
| Molecular Formula | C27H30INO |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CC/C(=C(/c1ccc(I)cc1)c1ccc(OCCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H30INO/c1-4-26(21-9-6-5-7-10-21)27(22-11-15-24(28)16-12-22)23-13-17-25(18-14-23)30-20-8-19-29(2)3/h5-7,9-18H,4,8,19-20H2,1-3H3/b27-26+ |
| InChIKey | GHWQLKYWYYHBMT-CYYJNZCTSA-N |
| XLogP | 6.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|