C26H28BrNO — CID 139774945
2-[4-[1-(3-bromophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 139774945) has the molecular formula C26H28BrNO and a molecular weight of 450.42 g/mol. Its IUPAC name is 2-[4-[1-(3-bromophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[1-(3-bromophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 139774945 |
| Molecular Formula | C26H28BrNO |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[4-[1-(3-bromophenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CCC(=C(c1ccc(OCCN(C)C)cc1)c1cccc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C26H28BrNO/c1-4-25(20-9-6-5-7-10-20)26(22-11-8-12-23(27)19-22)21-13-15-24(16-14-21)29-18-17-28(2)3/h5-16,19H,4,17-18H2,1-3H3 |
| InChIKey | DWXYMEXBBWCEID-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|