C27H31NO — CID 3037296
N,N-dimethyl-2-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine (PubChem CID 3037296) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 3037296 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N,N-dimethyl-2-[4-[(Z)-1-(4-methylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
| SMILES | CC/C(=C(\c1ccc(C)cc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO/c1-5-26(22-9-7-6-8-10-22)27(23-13-11-21(2)12-14-23)24-15-17-25(18-16-24)29-20-19-28(3)4/h6-18H,5,19-20H2,1-4H3/b27-26- |
| InChIKey | WXTLHLIBHUYVSV-RQZHXJHFSA-N |
| XLogP | 6.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|