C27H31NO2S — CID 14509105
N,N-dimethyl-2-[4-[(E)-1-(4-methylsulfinylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine (PubChem CID 14509105) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(E)-1-(4-methylsulfinylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[(E)-1-(4-methylsulfinylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 14509105 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N,N-dimethyl-2-[4-[(E)-1-(4-methylsulfinylphenyl)-2-phenylbut-1-enyl]phenoxy]ethanamine |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)c1ccc(S(C)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO2S/c1-5-26(21-9-7-6-8-10-21)27(23-13-17-25(18-14-23)31(4)29)22-11-15-24(16-12-22)30-20-19-28(2)3/h6-18H,5,19-20H2,1-4H3/b27-26+ |
| InChIKey | JRYLBWPPXFCWGL-CYYJNZCTSA-N |
| XLogP | 5.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|