C27H31NO2 — CID 177403376
2-[4-[(E)-1-(3-methoxyphenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 177403376) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[4-[(E)-1-(3-methoxyphenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(E)-1-(3-methoxyphenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 177403376 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[4-[(E)-1-(3-methoxyphenyl)-2-phenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)c1cccc(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO2/c1-5-26(21-10-7-6-8-11-21)27(23-12-9-13-25(20-23)29-4)22-14-16-24(17-15-22)30-19-18-28(2)3/h6-17,20H,5,18-19H2,1-4H3/b27-26+ |
| InChIKey | ZZBMFUPBXZQJLI-CYYJNZCTSA-N |
| XLogP | 6.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|