C27H30ClNO2 — CID 101270633
2-[4-[(Z)-2-(3-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 101270633) has the molecular formula C27H30ClNO2 and a molecular weight of 436.00 g/mol. Its IUPAC name is 2-[4-[(Z)-2-(3-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(Z)-2-(3-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 101270633 |
| Molecular Formula | C27H30ClNO2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-[4-[(Z)-2-(3-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CC/C(=C(\c1ccc(OC)cc1)c1ccc(OCCN(C)C)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H30ClNO2/c1-5-26(22-7-6-8-23(28)19-22)27(20-9-13-24(30-4)14-10-20)21-11-15-25(16-12-21)31-18-17-29(2)3/h6-16,19H,5,17-18H2,1-4H3/b27-26- |
| InChIKey | SUSFPLBIWHYDMY-RQZHXJHFSA-N |
| XLogP | 6.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|