C27H29Cl2NO2 — CID 10205424
2-[4-[(E)-4-chloro-2-(4-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 10205424) has the molecular formula C27H29Cl2NO2 and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[4-[(E)-4-chloro-2-(4-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(E)-4-chloro-2-(4-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10205424 |
| Molecular Formula | C27H29Cl2NO2 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-[4-[(E)-4-chloro-2-(4-chlorophenyl)-1-(4-methoxyphenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | COc1ccc(/C(=C(/CCCl)c2ccc(Cl)cc2)c2ccc(OCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H29Cl2NO2/c1-30(2)18-19-32-25-14-8-22(9-15-25)27(21-6-12-24(31-3)13-7-21)26(16-17-28)20-4-10-23(29)11-5-20/h4-15H,16-19H2,1-3H3/b27-26+ |
| InChIKey | DRHZAOIEHHBCKV-CYYJNZCTSA-N |
| XLogP | 6.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|