C26H26Cl3NO — CID 10116364
2-[4-[(Z)-4-chloro-1,2-bis(4-chlorophenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 10116364) has the molecular formula C26H26Cl3NO and a molecular weight of 474.86 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chloro-1,2-bis(4-chlorophenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(Z)-4-chloro-1,2-bis(4-chlorophenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10116364 |
| Molecular Formula | C26H26Cl3NO |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-bis(4-chlorophenyl)but-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(/C(=C(\CCCl)c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H26Cl3NO/c1-30(2)17-18-31-24-13-7-21(8-14-24)26(20-5-11-23(29)12-6-20)25(15-16-27)19-3-9-22(28)10-4-19/h3-14H,15-18H2,1-2H3/b26-25+ |
| InChIKey | ATNHJRWRNIUZLA-OCEACIFDSA-N |
| XLogP | 7.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|