C26H28ClNO — CID 6536897
2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 6536897) has the molecular formula C26H28ClNO and a molecular weight of 405.97 g/mol. Its IUPAC name is 2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 6536897 |
| Molecular Formula | C26H28ClNO |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[4-[(E)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(/C(=C(\CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28ClNO/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21/h3-16H,17-20H2,1-2H3/b26-25+ |
| InChIKey | XFCLJVABOIYOMF-OCEACIFDSA-N |
| XLogP | 6.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|