C25H28ClNO — CID 175021348
1-(4-chloro-1,2-diphenylbut-1-enyl)-4-ethoxybenzene;methanamine (PubChem CID 175021348) has the molecular formula C25H28ClNO and a molecular weight of 393.96 g/mol. Its IUPAC name is 1-(4-chloro-1,2-diphenylbut-1-enyl)-4-ethoxybenzene;methanamine.
| Compound Name | 1-(4-chloro-1,2-diphenylbut-1-enyl)-4-ethoxybenzene;methanamine |
|---|---|
| PubChem CID | 175021348 |
| Molecular Formula | C25H28ClNO |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-(4-chloro-1,2-diphenylbut-1-enyl)-4-ethoxybenzene;methanamine |
| SMILES | CCOc1ccc(C(=C(CCCl)c2ccccc2)c2ccccc2)cc1.CN |
| InChI | InChI=1S/C24H23ClO.CH5N/c1-2-26-22-15-13-21(14-16-22)24(20-11-7-4-8-12-20)23(17-18-25)19-9-5-3-6-10-19;1-2/h3-16H,2,17-18H2,1H3;2H2,1H3 |
| InChIKey | GOFUFOVGQNFQLV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|