C31H29ClO3 — CID 22504567
4-[(E)-4-chloro-1-phenyl-1-[4-(2-phenylmethoxyethoxy)phenyl]but-1-en-2-yl]phenol (PubChem CID 22504567) has the molecular formula C31H29ClO3 and a molecular weight of 485.02 g/mol. Its IUPAC name is 4-[(E)-4-chloro-1-phenyl-1-[4-(2-phenylmethoxyethoxy)phenyl]but-1-en-2-yl]phenol.
| Compound Name | 4-[(E)-4-chloro-1-phenyl-1-[4-(2-phenylmethoxyethoxy)phenyl]but-1-en-2-yl]phenol |
|---|---|
| PubChem CID | 22504567 |
| Molecular Formula | C31H29ClO3 |
| Molecular Weight | 485.02 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 4-[(E)-4-chloro-1-phenyl-1-[4-(2-phenylmethoxyethoxy)phenyl]but-1-en-2-yl]phenol |
| SMILES | Oc1ccc(/C(CCCl)=C(\c2ccccc2)c2ccc(OCCOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H29ClO3/c32-20-19-30(25-11-15-28(33)16-12-25)31(26-9-5-2-6-10-26)27-13-17-29(18-14-27)35-22-21-34-23-24-7-3-1-4-8-24/h1-18,33H,19-23H2/b31-30+ |
| InChIKey | KHBJZHMMPJKFIF-NVQSTNCTSA-N |
| XLogP | 7.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.02 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|