C29H31ClO3 — CID 90102187
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 90102187) has the molecular formula C29H31ClO3 and a molecular weight of 463.02 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90102187 |
| Molecular Formula | C29H31ClO3 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31ClO3/c1-29(2,3)28(31)33-21-20-32-25-16-14-24(15-17-25)27(23-12-8-5-9-13-23)26(18-19-30)22-10-6-4-7-11-22/h4-17H,18-21H2,1-3H3/b27-26- |
| InChIKey | BPLFFSYWSYUHGL-RQZHXJHFSA-N |
| XLogP | 7.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|