C24H24ClNO2 — CID 165015784
4-[1-[4-(2-aminoethoxy)phenyl]-4-chloro-1-phenylbut-1-en-2-yl]phenol (PubChem CID 165015784) has the molecular formula C24H24ClNO2 and a molecular weight of 393.91 g/mol. Its IUPAC name is 4-[1-[4-(2-aminoethoxy)phenyl]-4-chloro-1-phenylbut-1-en-2-yl]phenol.
| Compound Name | 4-[1-[4-(2-aminoethoxy)phenyl]-4-chloro-1-phenylbut-1-en-2-yl]phenol |
|---|---|
| PubChem CID | 165015784 |
| Molecular Formula | C24H24ClNO2 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-[1-[4-(2-aminoethoxy)phenyl]-4-chloro-1-phenylbut-1-en-2-yl]phenol |
| SMILES | NCCOc1ccc(C(=C(CCCl)c2ccc(O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24ClNO2/c25-15-14-23(18-6-10-21(27)11-7-18)24(19-4-2-1-3-5-19)20-8-12-22(13-9-20)28-17-16-26/h1-13,27H,14-17,26H2 |
| InChIKey | DDJKHOAAOODRGI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|