C28H31ClN2O2 — CID 166948738
4-[(Z)-4-chloro-2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol (PubChem CID 166948738) has the molecular formula C28H31ClN2O2 and a molecular weight of 463.02 g/mol. Its IUPAC name is 4-[(Z)-4-chloro-2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol.
| Compound Name | 4-[(Z)-4-chloro-2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 166948738 |
| Molecular Formula | C28H31ClN2O2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-[(Z)-4-chloro-2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol |
| SMILES | Oc1ccc(/C(=C(\CCCl)c2ccccc2)c2ccc(OCCN3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C28H31ClN2O2/c29-15-14-27(22-4-2-1-3-5-22)28(23-6-10-25(32)11-7-23)24-8-12-26(13-9-24)33-21-20-31-18-16-30-17-19-31/h1-13,30,32H,14-21H2/b28-27- |
| InChIKey | RSGPGOXLNFIGQM-DQSJHHFOSA-N |
| XLogP | 5.26 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|