C34H36N2O2 — CID 175489900
2-phenyl-4-[2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol (PubChem CID 175489900) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2-phenyl-4-[2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol.
| Compound Name | 2-phenyl-4-[2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 175489900 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 2-phenyl-4-[2-phenyl-1-[4-(2-piperazin-1-ylethoxy)phenyl]but-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(OCCN2CCNCC2)cc1)c1ccc(O)c(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C34H36N2O2/c1-2-31(26-9-5-3-6-10-26)34(29-15-18-33(37)32(25-29)27-11-7-4-8-12-27)28-13-16-30(17-14-28)38-24-23-36-21-19-35-20-22-36/h3-18,25,35,37H,2,19-24H2,1H3 |
| InChIKey | WHGVUGLIMHQFIK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|