C29H34N2O — CID 12888164
1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4-methylpiperazine (PubChem CID 12888164) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 12888164 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-4-methylpiperazine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN2CCN(C)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O/c1-3-28(24-10-6-4-7-11-24)29(25-12-8-5-9-13-25)26-14-16-27(17-15-26)32-23-22-31-20-18-30(2)19-21-31/h4-17H,3,18-23H2,1-2H3/b29-28- |
| InChIKey | BNMSAIMWMCGZDO-ZIADKAODSA-N |
| XLogP | 5.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|