C39H50N2O4 — CID 132566962
3-[1,1-bis[4-[2-(azepan-1-yl)ethoxy]phenyl]but-1-en-2-yl]benzoic acid (PubChem CID 132566962) has the molecular formula C39H50N2O4 and a molecular weight of 610.84 g/mol. Its IUPAC name is 3-[1,1-bis[4-[2-(azepan-1-yl)ethoxy]phenyl]but-1-en-2-yl]benzoic acid.
| Compound Name | 3-[1,1-bis[4-[2-(azepan-1-yl)ethoxy]phenyl]but-1-en-2-yl]benzoic acid |
|---|---|
| PubChem CID | 132566962 |
| Molecular Formula | C39H50N2O4 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | 3-[1,1-bis[4-[2-(azepan-1-yl)ethoxy]phenyl]but-1-en-2-yl]benzoic acid |
| SMILES | CCC(=C(c1ccc(OCCN2CCCCCC2)cc1)c1ccc(OCCN2CCCCCC2)cc1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C39H50N2O4/c1-2-37(33-12-11-13-34(30-33)39(42)43)38(31-14-18-35(19-15-31)44-28-26-40-22-7-3-4-8-23-40)32-16-20-36(21-17-32)45-29-27-41-24-9-5-6-10-25-41/h11-21,30H,2-10,22-29H2,1H3,(H,42,43) |
| InChIKey | GGYJDDYGIQXCOD-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|