C35H44N2O2 — CID 144608980
1-[3-[4-[(E)-2-phenyl-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]but-1-enyl]phenoxy]propyl]pyrrolidine (PubChem CID 144608980) has the molecular formula C35H44N2O2 and a molecular weight of 524.75 g/mol. Its IUPAC name is 1-[3-[4-[(E)-2-phenyl-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]but-1-enyl]phenoxy]propyl]pyrrolidine.
| Compound Name | 1-[3-[4-[(E)-2-phenyl-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]but-1-enyl]phenoxy]propyl]pyrrolidine |
|---|---|
| PubChem CID | 144608980 |
| Molecular Formula | C35H44N2O2 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | 1-[3-[4-[(E)-2-phenyl-1-[4-(2-pyrrolidin-1-ylethoxy)phenyl]but-1-enyl]phenoxy]propyl]pyrrolidine |
| SMILES | CC/C(=C(/c1ccc(OCCCN2CCCC2)cc1)c1ccc(OCCN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H44N2O2/c1-2-34(29-11-4-3-5-12-29)35(31-15-19-33(20-16-31)39-28-26-37-23-8-9-24-37)30-13-17-32(18-14-30)38-27-10-25-36-21-6-7-22-36/h3-5,11-20H,2,6-10,21-28H2,1H3/b35-34+ |
| InChIKey | CMAFPTJZNBYIED-XAHDOWKMSA-N |
| XLogP | 7.39 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|