C30H36N2O — CID 22868482
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-1-ylmethyl)ethanamine (PubChem CID 22868482) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-1-ylmethyl)ethanamine.
| Compound Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-1-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 22868482 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-1-ylmethyl)ethanamine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)CN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H36N2O/c1-3-29(25-12-6-4-7-13-25)30(26-14-8-5-9-15-26)27-16-18-28(19-17-27)33-23-22-31(2)24-32-20-10-11-21-32/h4-9,12-19H,3,10-11,20-24H2,1-2H3/b30-29- |
| InChIKey | AJMZVNVRMXFSSY-FLWNBWAVSA-N |
| XLogP | 6.42 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|