C28H31NO3 — CID 67397679
[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl acetate (PubChem CID 67397679) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is [2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl acetate.
| Compound Name | [2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl acetate |
|---|---|
| PubChem CID | 67397679 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl acetate |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)COC(C)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO3/c1-4-27(23-11-7-5-8-12-23)28(24-13-9-6-10-14-24)25-15-17-26(18-16-25)31-20-19-29(3)21-32-22(2)30/h5-18H,4,19-21H2,1-3H3/b28-27- |
| InChIKey | FWHVGSWSIOEYTE-DQSJHHFOSA-N |
| XLogP | 5.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|