C29H35NO2 — CID 67854533
1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-methylpropan-2-ol (PubChem CID 67854533) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 67854533 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 1-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-methylpropan-2-ol |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)CC(C)(C)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO2/c1-5-27(23-12-8-6-9-13-23)28(24-14-10-7-11-15-24)25-16-18-26(19-17-25)32-21-20-30(4)22-29(2,3)31/h6-19,31H,5,20-22H2,1-4H3/b28-27- |
| InChIKey | KJPPFEUOFYVLCS-DQSJHHFOSA-N |
| XLogP | 6.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|