C28H31NO2 — CID 166643688
N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methylpropanamide (PubChem CID 166643688) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methylpropanamide.
| Compound Name | N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 166643688 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)CCOc1ccc(C(=C(CC)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31NO2/c1-4-26(22-12-8-6-9-13-22)28(23-14-10-7-11-15-23)24-16-18-25(19-17-24)31-21-20-29(3)27(30)5-2/h6-19H,4-5,20-21H2,1-3H3 |
| InChIKey | HVHXHTPSGQGVOL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|