C30H35NO4 — CID 143870398
butyl N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylcarbamate (PubChem CID 143870398) has the molecular formula C30H35NO4 and a molecular weight of 473.61 g/mol. Its IUPAC name is butyl N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylcarbamate.
| Compound Name | butyl N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143870398 |
| Molecular Formula | C30H35NO4 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | butyl N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)CCOc1ccc(/C(=C(/CC)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C30H35NO4/c1-4-6-21-35-30(33)31(3)20-22-34-27-18-14-25(15-19-27)29(24-12-16-26(32)17-13-24)28(5-2)23-10-8-7-9-11-23/h7-19,32H,4-6,20-22H2,1-3H3/b29-28- |
| InChIKey | FMJPSOLWIVYOAD-ZIADKAODSA-N |
| XLogP | 7.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|