C52H59ClN2O4 — CID 174812460
bis(3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol);hydrochloride (PubChem CID 174812460) has the molecular formula C52H59ClN2O4 and a molecular weight of 811.51 g/mol. Its IUPAC name is bis(3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol);hydrochloride.
| Compound Name | bis(3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol);hydrochloride |
|---|---|
| PubChem CID | 174812460 |
| Molecular Formula | C52H59ClN2O4 |
| Molecular Weight | 811.51 g/mol |
| Exact Mass | 810.42 |
| IUPAC Name | bis(3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol);hydrochloride |
| SMILES | CCC(=C(c1ccc(OCCN(C)C)cc1)c1cccc(O)c1)c1ccccc1.CCC(=C(c1ccc(OCCN(C)C)cc1)c1cccc(O)c1)c1ccccc1.Cl |
| InChI | InChI=1S/2C26H29NO2.ClH/c2*1-4-25(20-9-6-5-7-10-20)26(22-11-8-12-23(28)19-22)21-13-15-24(16-14-21)29-18-17-27(2)3;/h2*5-16,19,28H,4,17-18H2,1-3H3;1H |
| InChIKey | BVFZUZDBGPTRKS-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.51 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|