C26H29BNO3 — CID 123937819
CID 123937819 (PubChem CID 123937819) has the molecular formula C26H29BNO3 and a molecular weight of 414.33 g/mol.
| Compound Name | CID 123937819 |
|---|---|
| PubChem CID | 123937819 |
| Molecular Formula | C26H29BNO3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | — |
| SMILES | CCC(=C(c1ccc(O[B]O)cc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H29BNO3/c1-4-25(20-8-6-5-7-9-20)26(22-12-16-24(17-13-22)31-27-29)21-10-14-23(15-11-21)30-19-18-28(2)3/h5-17,29H,4,18-19H2,1-3H3 |
| InChIKey | QOQJODVOLORONH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|