C28H31NO2 — CID 14509093
N,N-dimethyl-2-[4-[(Z)-1-[4-(oxiran-2-yl)phenyl]-2-phenylbut-1-enyl]phenoxy]ethanamine (PubChem CID 14509093) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(Z)-1-[4-(oxiran-2-yl)phenyl]-2-phenylbut-1-enyl]phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-[(Z)-1-[4-(oxiran-2-yl)phenyl]-2-phenylbut-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 14509093 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N,N-dimethyl-2-[4-[(Z)-1-[4-(oxiran-2-yl)phenyl]-2-phenylbut-1-enyl]phenoxy]ethanamine |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)c1ccc(C2CO2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO2/c1-4-26(21-8-6-5-7-9-21)28(23-12-10-22(11-13-23)27-20-31-27)24-14-16-25(17-15-24)30-19-18-29(2)3/h5-17,27H,4,18-20H2,1-3H3/b28-26- |
| InChIKey | BVGGWZHDSANJOQ-SGEDCAFJSA-N |
| XLogP | 6.07 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|