C33H35NO3 — CID 70684715
4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-phenylmethoxyphenyl)but-1-enyl]phenol (PubChem CID 70684715) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-phenylmethoxyphenyl)but-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-phenylmethoxyphenyl)but-1-enyl]phenol |
|---|---|
| PubChem CID | 70684715 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-phenylmethoxyphenyl)but-1-enyl]phenol |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN(C)C)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H35NO3/c1-4-32(26-12-18-31(19-13-26)37-24-25-8-6-5-7-9-25)33(27-10-16-29(35)17-11-27)28-14-20-30(21-15-28)36-23-22-34(2)3/h5-21,35H,4,22-24H2,1-3H3/b33-32- |
| InChIKey | UDSUYMJDKXZLDX-KARKAFJISA-N |
| XLogP | 7.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|