C24H28ClN3O2 — CID 71617027
4-[(Z)-1-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]-2-phenylbut-1-enyl]phenol;hydrochloride (PubChem CID 71617027) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 4-[(Z)-1-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]-2-phenylbut-1-enyl]phenol;hydrochloride.
| Compound Name | 4-[(Z)-1-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]-2-phenylbut-1-enyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 71617027 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-[(Z)-1-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]-2-phenylbut-1-enyl]phenol;hydrochloride |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ncc(OCCN(C)C)cn1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H27N3O2.ClH/c1-4-22(18-8-6-5-7-9-18)23(19-10-12-20(28)13-11-19)24-25-16-21(17-26-24)29-15-14-27(2)3;/h5-13,16-17,28H,4,14-15H2,1-3H3;1H/b23-22-; |
| InChIKey | YTTPOOPYNOEKJS-YJACDMIVSA-N |
| XLogP | 4.91 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|