C25H29ClN2O2 — CID 71617144
4-[(Z)-1-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-2-phenylbut-1-enyl]phenol;hydrochloride (PubChem CID 71617144) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is 4-[(Z)-1-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-2-phenylbut-1-enyl]phenol;hydrochloride.
| Compound Name | 4-[(Z)-1-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-2-phenylbut-1-enyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 71617144 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-[(Z)-1-[6-[2-(dimethylamino)ethoxy]-3-pyridinyl]-2-phenylbut-1-enyl]phenol;hydrochloride |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCN(C)C)nc1)c1ccccc1.Cl |
| InChI | InChI=1S/C25H28N2O2.ClH/c1-4-23(19-8-6-5-7-9-19)25(20-10-13-22(28)14-11-20)21-12-15-24(26-18-21)29-17-16-27(2)3;/h5-15,18,28H,4,16-17H2,1-3H3;1H/b25-23-; |
| InChIKey | SSRXNMFZGUTIMY-ADYMNVQMSA-N |
| XLogP | 5.52 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|