C30H37NO3 — CID 143870405
ethane;N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylpropanamide (PubChem CID 143870405) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is ethane;N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylpropanamide.
| Compound Name | ethane;N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 143870405 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | ethane;N-[2-[4-[(Z)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-N-methylpropanamide |
| SMILES | CC.CCC(=O)N(C)CCOc1ccc(/C(=C(/CC)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C28H31NO3.C2H6/c1-4-26(21-9-7-6-8-10-21)28(22-11-15-24(30)16-12-22)23-13-17-25(18-14-23)32-20-19-29(3)27(31)5-2;1-2/h6-18,30H,4-5,19-20H2,1-3H3;1-2H3/b28-26-; |
| InChIKey | MWYGEOIMAASKLJ-QVLVYXDLSA-N |
| XLogP | 7.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|