C39H52N2O8 — CID 134174442
3-[2-[2-[2-[2-[3-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 134174442) has the molecular formula C39H52N2O8 and a molecular weight of 676.85 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[3-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | 3-[2-[2-[2-[2-[3-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 134174442 |
| Molecular Formula | C39H52N2O8 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | 3-[2-[2-[2-[2-[3-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)C(=O)CCOCCOCCOCCOCCOCCC(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C39H52N2O8/c1-3-36(32-10-6-4-7-11-32)39(33-12-8-5-9-13-33)34-14-16-35(17-15-34)49-23-20-41(2)38(43)19-22-45-25-27-47-29-31-48-30-28-46-26-24-44-21-18-37(40)42/h4-17H,3,18-31H2,1-2H3,(H2,40,42)/b39-36- |
| InChIKey | LOZGGSDJCAXRDL-HYLXNHFUSA-N |
| XLogP | 5.24 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|