C31H38FNO — CID 18650177
N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-(fluoromethyl)-N-methylpentan-3-amine (PubChem CID 18650177) has the molecular formula C31H38FNO and a molecular weight of 459.65 g/mol. Its IUPAC name is N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-(fluoromethyl)-N-methylpentan-3-amine.
| Compound Name | N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-(fluoromethyl)-N-methylpentan-3-amine |
|---|---|
| PubChem CID | 18650177 |
| Molecular Formula | C31H38FNO |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | N-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-3-(fluoromethyl)-N-methylpentan-3-amine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)C(CC)(CC)CF)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H38FNO/c1-5-29(25-14-10-8-11-15-25)30(26-16-12-9-13-17-26)27-18-20-28(21-19-27)34-23-22-33(4)31(6-2,7-3)24-32/h8-21H,5-7,22-24H2,1-4H3/b30-29- |
| InChIKey | VOROQSHMZDEHTQ-FLWNBWAVSA-N |
| XLogP | 7.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|