C29H33NO3 — CID 174408704
[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl propanoate (PubChem CID 174408704) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is [2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl propanoate.
| Compound Name | [2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl propanoate |
|---|---|
| PubChem CID | 174408704 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | [2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]methyl propanoate |
| SMILES | CCC(=O)OCN(C)CCOc1ccc(/C(=C(/CC)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H33NO3/c1-4-27(23-12-8-6-9-13-23)29(24-14-10-7-11-15-24)25-16-18-26(19-17-25)32-21-20-30(3)22-33-28(31)5-2/h6-19H,4-5,20-22H2,1-3H3/b29-27- |
| InChIKey | WSJLOJDRKPVKOS-OHYPFYFLSA-N |
| XLogP | 6.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|