C26H30NO4P — CID 76835085
N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-methoxy-N-methylphosphonamidic acid (PubChem CID 76835085) has the molecular formula C26H30NO4P and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-methoxy-N-methylphosphonamidic acid.
| Compound Name | N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-methoxy-N-methylphosphonamidic acid |
|---|---|
| PubChem CID | 76835085 |
| Molecular Formula | C26H30NO4P |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-methoxy-N-methylphosphonamidic acid |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCN(C)P(=O)(O)OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H30NO4P/c1-4-25(21-11-7-5-8-12-21)26(22-13-9-6-10-14-22)23-15-17-24(18-16-23)31-20-19-27(2)32(28,29)30-3/h5-18H,4,19-20H2,1-3H3,(H,28,29) |
| InChIKey | QCCOGESSTNELGT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|