C31H32NO4P — CID 76835087
N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methyl-phenoxyphosphonamidic acid (PubChem CID 76835087) has the molecular formula C31H32NO4P and a molecular weight of 513.57 g/mol. Its IUPAC name is N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methyl-phenoxyphosphonamidic acid.
| Compound Name | N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methyl-phenoxyphosphonamidic acid |
|---|---|
| PubChem CID | 76835087 |
| Molecular Formula | C31H32NO4P |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-[2-[4-(1,2-diphenylbut-1-enyl)phenoxy]ethyl]-N-methyl-phenoxyphosphonamidic acid |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCN(C)P(=O)(O)Oc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H32NO4P/c1-3-30(25-13-7-4-8-14-25)31(26-15-9-5-10-16-26)27-19-21-28(22-20-27)35-24-23-32(2)37(33,34)36-29-17-11-6-12-18-29/h4-22H,3,23-24H2,1-2H3,(H,33,34) |
| InChIKey | CGMGDVYHFURZSE-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|