C25H31NO9P2 — CID 173074726
[4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] dihydrogen phosphate;phosphoric acid (PubChem CID 173074726) has the molecular formula C25H31NO9P2 and a molecular weight of 551.47 g/mol. Its IUPAC name is [4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] dihydrogen phosphate;phosphoric acid.
| Compound Name | [4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] dihydrogen phosphate;phosphoric acid |
|---|---|
| PubChem CID | 173074726 |
| Molecular Formula | C25H31NO9P2 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | [4-[1-[4-[2-(methylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] dihydrogen phosphate;phosphoric acid |
| SMILES | CCC(=C(c1ccc(OCCNC)cc1)c1ccc(OP(=O)(O)O)cc1)c1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C25H28NO5P.H3O4P/c1-3-24(19-7-5-4-6-8-19)25(20-9-13-22(14-10-20)30-18-17-26-2)21-11-15-23(16-12-21)31-32(27,28)29;1-5(2,3)4/h4-16,26H,3,17-18H2,1-2H3,(H2,27,28,29);(H3,1,2,3,4) |
| InChIKey | DAQPGQKNSMIUJD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|