C26H22O8P2 — CID 155895268
[4-[1,2-diphenyl-2-(4-phosphonooxyphenyl)ethenyl]phenyl] dihydrogen phosphate (PubChem CID 155895268) has the molecular formula C26H22O8P2 and a molecular weight of 524.40 g/mol. Its IUPAC name is [4-[1,2-diphenyl-2-(4-phosphonooxyphenyl)ethenyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[1,2-diphenyl-2-(4-phosphonooxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155895268 |
| Molecular Formula | C26H22O8P2 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | [4-[1,2-diphenyl-2-(4-phosphonooxyphenyl)ethenyl]phenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1ccc(C(=C(c2ccccc2)c2ccc(OP(=O)(O)O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22O8P2/c27-35(28,29)33-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(18-14-22)34-36(30,31)32/h1-18H,(H2,27,28,29)(H2,30,31,32) |
| InChIKey | AHEKEONWUHBVNV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|