C25H25F2NO — CID 70876118
2-[4-[(E)-1,2-bis(4-fluorophenyl)but-1-enyl]phenoxy]-N-methylethanamine (PubChem CID 70876118) has the molecular formula C25H25F2NO and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[4-[(E)-1,2-bis(4-fluorophenyl)but-1-enyl]phenoxy]-N-methylethanamine.
| Compound Name | 2-[4-[(E)-1,2-bis(4-fluorophenyl)but-1-enyl]phenoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 70876118 |
| Molecular Formula | C25H25F2NO |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[4-[(E)-1,2-bis(4-fluorophenyl)but-1-enyl]phenoxy]-N-methylethanamine |
| SMILES | CC/C(=C(\c1ccc(F)cc1)c1ccc(OCCNC)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25F2NO/c1-3-24(18-4-10-21(26)11-5-18)25(19-6-12-22(27)13-7-19)20-8-14-23(15-9-20)29-17-16-28-2/h4-15,28H,3,16-17H2,1-2H3/b25-24- |
| InChIKey | AJHDQKLVHWLMCI-IZHYLOQSSA-N |
| XLogP | 5.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|