C26H26N2O3 — CID 78135005
4-[2-(1,3-benzoxazol-5-yl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-enyl]phenol (PubChem CID 78135005) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[2-(1,3-benzoxazol-5-yl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-enyl]phenol.
| Compound Name | 4-[2-(1,3-benzoxazol-5-yl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 78135005 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-[2-(1,3-benzoxazol-5-yl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-enyl]phenol |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCNC)cc1)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C26H26N2O3/c1-3-23(20-8-13-25-24(16-20)28-17-31-25)26(18-4-9-21(29)10-5-18)19-6-11-22(12-7-19)30-15-14-27-2/h4-13,16-17,27,29H,3,14-15H2,1-2H3 |
| InChIKey | URFHOBGOEQTCDX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|