C27H28N2O2 — CID 149496652
4-[(Z)-1-(4-butoxyphenyl)-2-(1H-indazol-5-yl)but-1-enyl]phenol (PubChem CID 149496652) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-[(Z)-1-(4-butoxyphenyl)-2-(1H-indazol-5-yl)but-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-(4-butoxyphenyl)-2-(1H-indazol-5-yl)but-1-enyl]phenol |
|---|---|
| PubChem CID | 149496652 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-[(Z)-1-(4-butoxyphenyl)-2-(1H-indazol-5-yl)but-1-enyl]phenol |
| SMILES | CCCCOc1ccc(/C(=C(/CC)c2ccc3[nH]ncc3c2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O2/c1-3-5-16-31-24-13-8-20(9-14-24)27(19-6-11-23(30)12-7-19)25(4-2)21-10-15-26-22(17-21)18-28-29-26/h6-15,17-18,30H,3-5,16H2,1-2H3,(H,28,29)/b27-25- |
| InChIKey | ZGEAEVROXQUXID-RFBIWTDZSA-N |
| XLogP | 6.82 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|