C32H34N2O3 — CID 174699348
[2-[(E)-2-(4-hexoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate (PubChem CID 174699348) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is [2-[(E)-2-(4-hexoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-2-(4-hexoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174699348 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | [2-[(E)-2-(4-hexoxyphenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(\CC)c1ccc(OCCCCCC)cc1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C32H34N2O3/c1-4-7-8-11-20-36-26-17-14-23(15-18-26)27(5-2)32(24-16-19-29-25(21-24)22-33-34-29)28-12-9-10-13-30(28)37-31(35)6-3/h6,9-10,12-19,21-22H,3-5,7-8,11,20H2,1-2H3,(H,33,34)/b32-27+ |
| InChIKey | YQSSOWDTRYKPCS-QVAGMWBUSA-N |
| XLogP | 7.98 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|