C24H22N2O — CID 141327801
5-[(E)-2-(2-methoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole (PubChem CID 141327801) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 5-[(E)-2-(2-methoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole.
| Compound Name | 5-[(E)-2-(2-methoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole |
|---|---|
| PubChem CID | 141327801 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[(E)-2-(2-methoxyphenyl)-1-phenylbut-1-enyl]-1H-indazole |
| SMILES | CC/C(=C(/c1ccccc1)c1ccc2[nH]ncc2c1)c1ccccc1OC |
| InChI | InChI=1S/C24H22N2O/c1-3-20(21-11-7-8-12-23(21)27-2)24(17-9-5-4-6-10-17)18-13-14-22-19(15-18)16-25-26-22/h4-16H,3H2,1-2H3,(H,25,26)/b24-20+ |
| InChIKey | FTCHQXXUCAZCLN-HIXSDJFHSA-N |
| XLogP | 5.94 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|